C22H35IN4O2 — CID 111721174
tert-butyl 4-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111721174) has the molecular formula C22H35IN4O2 and a molecular weight of 514.45 g/mol. Its IUPAC name is tert-butyl 4-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111721174 |
| Molecular Formula | C22H35IN4O2 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | tert-butyl 4-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCC(C/N=C(\N)Nc2cccc3c2CCCC3)CC1.I |
| InChI | InChI=1S/C22H34N4O2.HI/c1-22(2,3)28-21(27)26-13-11-16(12-14-26)15-24-20(23)25-19-10-6-8-17-7-4-5-9-18(17)19;/h6,8,10,16H,4-5,7,9,11-15H2,1-3H3,(H3,23,24,25);1H |
| InChIKey | CLRYKDPPYIUUAF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|