C19H31IN4O3 — CID 111062979
tert-butyl 4-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111062979) has the molecular formula C19H31IN4O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is tert-butyl 4-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111062979 |
| Molecular Formula | C19H31IN4O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | tert-butyl 4-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/CC1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C19H30N4O3.HI/c1-19(2,3)26-18(24)23-11-9-14(10-12-23)13-21-17(20)22-15-7-5-6-8-16(15)25-4;/h5-8,14H,9-13H2,1-4H3,(H3,20,21,22);1H |
| InChIKey | ITYQZKYHVGELFP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|