C16H27IN4S — CID 110030642
1-cyclopropyl-1-methyl-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 110030642) has the molecular formula C16H27IN4S and a molecular weight of 434.39 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110030642 |
| Molecular Formula | C16H27IN4S |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CC1CCCN(Cc2cccs2)C1)C1CC1.I |
| InChI | InChI=1S/C16H26N4S.HI/c1-19(14-6-7-14)16(17)18-10-13-4-2-8-20(11-13)12-15-5-3-9-21-15;/h3,5,9,13-14H,2,4,6-8,10-12H2,1H3,(H2,17,18);1H |
| InChIKey | IWCGOKWBUHLHDL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|