C20H34N4OS — CID 109385084
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine (PubChem CID 109385084) has the molecular formula C20H34N4OS and a molecular weight of 378.59 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109385084 |
| Molecular Formula | C20H34N4OS |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCCN(Cc2cccs2)C1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C20H34N4OS/c1-3-21-20(23(2)13-18-8-10-25-16-18)22-12-17-6-4-9-24(14-17)15-19-7-5-11-26-19/h5,7,11,17-18H,3-4,6,8-10,12-16H2,1-2H3,(H,21,22) |
| InChIKey | CFTWQGIUKCUQJN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|