C27H40IN5O — CID 109386916
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 109386916) has the molecular formula C27H40IN5O and a molecular weight of 577.56 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109386916 |
| Molecular Formula | C27H40IN5O |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCN(c2ccccc2)CC1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C27H39N5O.HI/c1-3-28-27(30(2)20-23-13-18-33-22-23)29-19-24-9-7-8-10-25(24)21-31-14-16-32(17-15-31)26-11-5-4-6-12-26;/h4-12,23H,3,13-22H2,1-2H3,(H,28,29);1H |
| InChIKey | ABCKIAOIMBEFRJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|