C22H36FN5O — CID 109383396
3-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109383396) has the molecular formula C22H36FN5O and a molecular weight of 405.56 g/mol. Its IUPAC name is 3-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109383396 |
| Molecular Formula | C22H36FN5O |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 3-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CCCN1CCN(c2ccccc2F)CC1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C22H36FN5O/c1-3-24-22(26(2)17-19-9-16-29-18-19)25-10-6-11-27-12-14-28(15-13-27)21-8-5-4-7-20(21)23/h4-5,7-8,19H,3,6,9-18H2,1-2H3,(H,24,25) |
| InChIKey | VOVAZYYNLYBYPR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|