C22H38FIN6O — CID 111762224
1-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111762224) has the molecular formula C22H38FIN6O and a molecular weight of 548.49 g/mol. Its IUPAC name is 1-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111762224 |
| Molecular Formula | C22H38FIN6O |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 1-ethyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCN(c2ccccc2F)CC1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C22H37FN6O.HI/c1-2-24-22(26-9-11-28-16-18-30-19-17-28)25-8-5-10-27-12-14-29(15-13-27)21-7-4-3-6-20(21)23;/h3-4,6-7H,2,5,8-19H2,1H3,(H2,24,25,26);1H |
| InChIKey | PNBKTJCUVFIVSI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|