C18H38N6O — CID 111187649
1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111187649) has the molecular formula C18H38N6O and a molecular weight of 354.54 g/mol. Its IUPAC name is 1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111187649 |
| Molecular Formula | C18H38N6O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | 1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCCCN1CCN(C)CC1)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H38N6O/c1-3-19-18(21-7-9-24-14-16-25-17-15-24)20-6-4-5-8-23-12-10-22(2)11-13-23/h3-17H2,1-2H3,(H2,19,20,21) |
| InChIKey | DJATZOQCFOJLSR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|