C16H32N4O3 — CID 110971881
methyl 5-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]pentanoate (PubChem CID 110971881) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is methyl 5-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]pentanoate.
| Compound Name | methyl 5-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 110971881 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | methyl 5-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]pentanoate |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NCCCCC(=O)OC |
| InChI | InChI=1S/C16H32N4O3/c1-3-17-16(18-8-5-4-7-15(21)22-2)19-9-6-10-20-11-13-23-14-12-20/h3-14H2,1-2H3,(H2,17,18,19) |
| InChIKey | LKDPJSBLPYDUKJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|