C21H37IN4OS — CID 111960274
4-ethoxy-N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111960274) has the molecular formula C21H37IN4OS and a molecular weight of 520.53 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111960274 |
| Molecular Formula | C21H37IN4OS |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN(Cc2cccs2)C1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C21H36N4OS.HI/c1-3-22-21(25-12-9-19(10-13-25)26-4-2)23-15-18-7-5-11-24(16-18)17-20-8-6-14-27-20;/h6,8,14,18-19H,3-5,7,9-13,15-17H2,1-2H3,(H,22,23);1H |
| InChIKey | DOIPXDWBQGZVJZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|