C23H39N5O2S — CID 111730803
tert-butyl N-[1-[N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730803) has the molecular formula C23H39N5O2S and a molecular weight of 449.67 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730803 |
| Molecular Formula | C23H39N5O2S |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CC1CCCN(Cc2cccs2)C1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H39N5O2S/c1-5-24-21(28-12-10-19(16-28)26-22(29)30-23(2,3)4)25-14-18-8-6-11-27(15-18)17-20-9-7-13-31-20/h7,9,13,18-19H,5-6,8,10-12,14-17H2,1-4H3,(H,24,25)(H,26,29) |
| InChIKey | PRIDWJVJLMKBNZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|