C20H40N6O2 — CID 111728979
tert-butyl N-[1-[N-ethyl-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111728979) has the molecular formula C20H40N6O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111728979 |
| Molecular Formula | C20H40N6O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CCN1CCCN(C)CC1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H40N6O2/c1-6-21-18(22-9-13-25-11-7-10-24(5)14-15-25)26-12-8-17(16-26)23-19(27)28-20(2,3)4/h17H,6-16H2,1-5H3,(H,21,22)(H,23,27) |
| InChIKey | JORDGXVLGWEQTA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|