C21H42N6O2 — CID 111730473
tert-butyl N-[1-[N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730473) has the molecular formula C21H42N6O2 and a molecular weight of 410.61 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730473 |
| Molecular Formula | C21H42N6O2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CC(C)CN1CCN(C)CC1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H42N6O2/c1-7-22-19(23-14-17(2)15-26-12-10-25(6)11-13-26)27-9-8-18(16-27)24-20(28)29-21(3,4)5/h17-18H,7-16H2,1-6H3,(H,22,23)(H,24,28) |
| InChIKey | ARIJAEDKJVVLFV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|