C22H36N4O5 — CID 111993333
tert-butyl N-[1-[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111993333) has the molecular formula C22H36N4O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111993333 |
| Molecular Formula | C22H36N4O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | tert-butyl N-[1-[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)cc(OC)c1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H36N4O5/c1-7-23-20(26-9-8-16(14-26)25-21(28)31-22(2,3)4)24-13-19(27)15-10-17(29-5)12-18(11-15)30-6/h10-12,16,19,27H,7-9,13-14H2,1-6H3,(H,23,24)(H,25,28) |
| InChIKey | CUTHBSDFPYPVQQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|