C17H34N4O4 — CID 111730529
tert-butyl N-[1-[N-ethyl-N'-[2-(2-methoxyethoxy)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730529) has the molecular formula C17H34N4O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[2-(2-methoxyethoxy)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[2-(2-methoxyethoxy)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730529 |
| Molecular Formula | C17H34N4O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[2-(2-methoxyethoxy)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CCOCCOC)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H34N4O4/c1-6-18-15(19-8-10-24-12-11-23-5)21-9-7-14(13-21)20-16(22)25-17(2,3)4/h14H,6-13H2,1-5H3,(H,18,19)(H,20,22) |
| InChIKey | XSIRWEBNAYWADF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|