C18H34N4O4 — CID 111729715
ethyl 4-[[ethylamino-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]methylidene]amino]butanoate (PubChem CID 111729715) has the molecular formula C18H34N4O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is ethyl 4-[[ethylamino-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]methylidene]amino]butanoate.
| Compound Name | ethyl 4-[[ethylamino-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]methylidene]amino]butanoate |
|---|---|
| PubChem CID | 111729715 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | ethyl 4-[[ethylamino-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]methylidene]amino]butanoate |
| SMILES | CCN/C(=N\CCCC(=O)OCC)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H34N4O4/c1-6-19-16(20-11-8-9-15(23)25-7-2)22-12-10-14(13-22)21-17(24)26-18(3,4)5/h14H,6-13H2,1-5H3,(H,19,20)(H,21,24) |
| InChIKey | FXXRZJAHKCRMQV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|