C20H38N4O4 — CID 111729471
ethyl 7-[[N-methyl-C-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]carbonimidoyl]amino]heptanoate (PubChem CID 111729471) has the molecular formula C20H38N4O4 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 7-[[N-methyl-C-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]carbonimidoyl]amino]heptanoate.
| Compound Name | ethyl 7-[[N-methyl-C-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]carbonimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111729471 |
| Molecular Formula | C20H38N4O4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | ethyl 7-[[N-methyl-C-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]carbonimidoyl]amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN/C(=N\C)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H38N4O4/c1-6-27-17(25)11-9-7-8-10-13-22-18(21-5)24-14-12-16(15-24)23-19(26)28-20(2,3)4/h16H,6-15H2,1-5H3,(H,21,22)(H,23,26) |
| InChIKey | MPUCRWMZLLKKSB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|