C17H35N5O3 — CID 111729253
tert-butyl N-[1-[N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729253) has the molecular formula C17H35N5O3 and a molecular weight of 357.50 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729253 |
| Molecular Formula | C17H35N5O3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | tert-butyl N-[1-[N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(\NCCN(C)CCOC)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H35N5O3/c1-17(2,3)25-16(23)20-14-7-9-22(13-14)15(18-4)19-8-10-21(5)11-12-24-6/h14H,7-13H2,1-6H3,(H,18,19)(H,20,23) |
| InChIKey | VBZJNNMTNUGDGS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|