C20H39N5O3 — CID 111730587
tert-butyl N-[1-[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730587) has the molecular formula C20H39N5O3 and a molecular weight of 397.56 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730587 |
| Molecular Formula | C20H39N5O3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | tert-butyl N-[1-[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(\NCCCN1CC(C)OC(C)C1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H39N5O3/c1-15-12-24(13-16(2)27-15)10-7-9-22-18(21-6)25-11-8-17(14-25)23-19(26)28-20(3,4)5/h15-17H,7-14H2,1-6H3,(H,21,22)(H,23,26) |
| InChIKey | KTIYKOHTQBSARX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|