C20H35IN4OS — CID 111736932
N-ethyl-3-(methoxymethyl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111736932) has the molecular formula C20H35IN4OS and a molecular weight of 506.50 g/mol. Its IUPAC name is N-ethyl-3-(methoxymethyl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-(methoxymethyl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111736932 |
| Molecular Formula | C20H35IN4OS |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-ethyl-3-(methoxymethyl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(Cc2cccs2)CC1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C20H34N4OS.HI/c1-3-21-20(24-11-8-18(14-24)16-25-2)22-13-17-6-9-23(10-7-17)15-19-5-4-12-26-19;/h4-5,12,17-18H,3,6-11,13-16H2,1-2H3,(H,21,22);1H |
| InChIKey | LZGRSMCAFWNBJT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|