C19H34N4S — CID 111000861
1-ethyl-3-(3-methylbutan-2-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111000861) has the molecular formula C19H34N4S and a molecular weight of 350.58 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylbutan-2-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-methylbutan-2-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111000861 |
| Molecular Formula | C19H34N4S |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 1-ethyl-3-(3-methylbutan-2-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(Cc2cccs2)CC1)NC(C)C(C)C |
| InChI | InChI=1S/C19H34N4S/c1-5-20-19(22-16(4)15(2)3)21-13-17-8-10-23(11-9-17)14-18-7-6-12-24-18/h6-7,12,15-17H,5,8-11,13-14H2,1-4H3,(H2,20,21,22) |
| InChIKey | AHTRHFKTEUXMDR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|