C24H42N4OS — CID 111623436
1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111623436) has the molecular formula C24H42N4OS and a molecular weight of 434.69 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111623436 |
| Molecular Formula | C24H42N4OS |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(Cc2cccs2)CC1)NCC1CCCOC1C(C)(C)C |
| InChI | InChI=1S/C24H42N4OS/c1-5-25-23(27-17-20-8-6-14-29-22(20)24(2,3)4)26-16-19-10-12-28(13-11-19)18-21-9-7-15-30-21/h7,9,15,19-20,22H,5-6,8,10-14,16-18H2,1-4H3,(H2,25,26,27) |
| InChIKey | YKGBPNZORARTLV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|