C21H37N5S — CID 111416137
1-ethyl-3-(2-piperidin-1-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111416137) has the molecular formula C21H37N5S and a molecular weight of 391.63 g/mol. Its IUPAC name is 1-ethyl-3-(2-piperidin-1-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-piperidin-1-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111416137 |
| Molecular Formula | C21H37N5S |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 1-ethyl-3-(2-piperidin-1-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(Cc2cccs2)CC1)NCCN1CCCCC1 |
| InChI | InChI=1S/C21H37N5S/c1-2-22-21(23-10-15-25-11-4-3-5-12-25)24-17-19-8-13-26(14-9-19)18-20-7-6-16-27-20/h6-7,16,19H,2-5,8-15,17-18H2,1H3,(H2,22,23,24) |
| InChIKey | AOBLKTOSDWAHDK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|