C21H31N5S — CID 111193236
1-ethyl-3-(2-pyridin-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine (PubChem CID 111193236) has the molecular formula C21H31N5S and a molecular weight of 385.58 g/mol. Its IUPAC name is 1-ethyl-3-(2-pyridin-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-pyridin-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111193236 |
| Molecular Formula | C21H31N5S |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-ethyl-3-(2-pyridin-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCCN(Cc2cccs2)C1)NCCc1ccccn1 |
| InChI | InChI=1S/C21H31N5S/c1-2-22-21(24-12-10-19-8-3-4-11-23-19)25-15-18-7-5-13-26(16-18)17-20-9-6-14-27-20/h3-4,6,8-9,11,14,18H,2,5,7,10,12-13,15-17H2,1H3,(H2,22,24,25) |
| InChIKey | KHJHOTQHIZJVBX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|