C22H37IN6S — CID 111279340
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111279340) has the molecular formula C22H37IN6S and a molecular weight of 544.55 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111279340 |
| Molecular Formula | C22H37IN6S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(Cc2cccs2)CC1)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C22H36N6S.HI/c1-4-23-22(24-10-6-11-28-19(3)15-18(2)26-28)25-16-20-8-12-27(13-9-20)17-21-7-5-14-29-21;/h5,7,14-15,20H,4,6,8-13,16-17H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | LCEOBLQCEPYFFG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|