C24H40IN7 — CID 111280090
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111280090) has the molecular formula C24H40IN7 and a molecular weight of 553.54 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111280090 |
| Molecular Formula | C24H40IN7 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCCN1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C24H39N7.HI/c1-4-25-24(27-13-9-15-31-22(3)20-21(2)28-31)26-12-8-14-29-16-18-30(19-17-29)23-10-6-5-7-11-23;/h5-7,10-11,20H,4,8-9,12-19H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | VWNQEGRZZQXQIR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|