C20H35N5S — CID 111344175
1-ethyl-3-(2-methylsulfanylethyl)-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine (PubChem CID 111344175) has the molecular formula C20H35N5S and a molecular weight of 377.60 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylsulfanylethyl)-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methylsulfanylethyl)-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111344175 |
| Molecular Formula | C20H35N5S |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 1-ethyl-3-(2-methylsulfanylethyl)-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCN1CCN(c2ccccc2)CC1)NCCSC |
| InChI | InChI=1S/C20H35N5S/c1-3-21-20(23-12-18-26-2)22-11-7-8-13-24-14-16-25(17-15-24)19-9-5-4-6-10-19/h4-6,9-10H,3,7-8,11-18H2,1-2H3,(H2,21,22,23) |
| InChIKey | RVDIGKVVELABEU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|