C22H40IN5O — CID 111607546
1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide (PubChem CID 111607546) has the molecular formula C22H40IN5O and a molecular weight of 517.50 g/mol. Its IUPAC name is 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111607546 |
| Molecular Formula | C22H40IN5O |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)OC)NCCCCN1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H39N5O.HI/c1-5-23-21(25-19-22(2,3)28-4)24-13-9-10-14-26-15-17-27(18-16-26)20-11-7-6-8-12-20;/h6-8,11-12H,5,9-10,13-19H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | HPMCSORJIVZEEH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|