C25H42IN7 — CID 111280460
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide (PubChem CID 111280460) has the molecular formula C25H42IN7 and a molecular weight of 567.56 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111280460 |
| Molecular Formula | C25H42IN7 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCCCN1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C25H41N7.HI/c1-4-26-25(28-14-10-16-32-23(3)21-22(2)29-32)27-13-8-9-15-30-17-19-31(20-18-30)24-11-6-5-7-12-24;/h5-7,11-12,21H,4,8-10,13-20H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | XXPPBJFUWVGFBP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|