C22H42N6 — CID 111278459
1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine (PubChem CID 111278459) has the molecular formula C22H42N6 and a molecular weight of 390.62 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111278459 |
| Molecular Formula | C22H42N6 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C22H42N6/c1-6-23-22(25-11-9-13-28-21(5)15-20(4)26-28)24-10-7-8-12-27-16-18(2)14-19(3)17-27/h15,18-19H,6-14,16-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | GNESVWBNJSVJHD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|