C15H31IN6O2S — CID 111279484
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide (PubChem CID 111279484) has the molecular formula C15H31IN6O2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111279484 |
| Molecular Formula | C15H31IN6O2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCNS(=O)(=O)CC.I |
| InChI | InChI=1S/C15H30N6O2S.HI/c1-5-16-15(18-9-10-19-24(22,23)6-2)17-8-7-11-21-14(4)12-13(3)20-21;/h12,19H,5-11H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | QTWPKYMQHREGFA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|