C19H30N6O2S — CID 111280831
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine (PubChem CID 111280831) has the molecular formula C19H30N6O2S and a molecular weight of 406.56 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111280831 |
| Molecular Formula | C19H30N6O2S |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H30N6O2S/c1-4-21-19(22-11-5-13-25-16(3)14-15(2)24-25)23-12-10-17-6-8-18(9-7-17)28(20,26)27/h6-9,14H,4-5,10-13H2,1-3H3,(H2,20,26,27)(H2,21,22,23) |
| InChIKey | ZHQSOEILHFGVQD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|