C21H34N6O2S — CID 111277989
1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine (PubChem CID 111277989) has the molecular formula C21H34N6O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111277989 |
| Molecular Formula | C21H34N6O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCNS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C21H34N6O2S/c1-6-22-21(23-10-7-13-27-19(5)15-18(4)26-27)24-11-12-25-30(28,29)20-14-16(2)8-9-17(20)3/h8-9,14-15,25H,6-7,10-13H2,1-5H3,(H2,22,23,24) |
| InChIKey | MPVWJKLQWFEUIY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|