C18H35IN6O2S — CID 111783808
1-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide (PubChem CID 111783808) has the molecular formula C18H35IN6O2S and a molecular weight of 526.49 g/mol. Its IUPAC name is 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111783808 |
| Molecular Formula | C18H35IN6O2S |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCS(=O)(=O)NCC1CCC1.I |
| InChI | InChI=1S/C18H34N6O2S.HI/c1-4-19-18(20-9-6-11-24-16(3)13-15(2)23-24)21-10-12-27(25,26)22-14-17-7-5-8-17;/h13,17,22H,4-12,14H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | MSMPTTMGWQAKTA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|