C13H29IN4O2S2 — CID 111785386
1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111785386) has the molecular formula C13H29IN4O2S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111785386 |
| Molecular Formula | C13H29IN4O2S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCSC)NCCS(=O)(=O)NCC1CCC1.I |
| InChI | InChI=1S/C13H28N4O2S2.HI/c1-3-14-13(15-7-9-20-2)16-8-10-21(18,19)17-11-12-5-4-6-12;/h12,17H,3-11H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | XXGZOENHXLTMJH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|