C13H24N4O2S — CID 136923815
2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-ethyl-3-prop-2-ynylguanidine (PubChem CID 136923815) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-ethyl-3-prop-2-ynylguanidine.
| Compound Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-ethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 136923815 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-ethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CCS(=O)(=O)NCC1CCC1)NCC |
| InChI | InChI=1S/C13H24N4O2S/c1-3-8-15-13(14-4-2)16-9-10-20(18,19)17-11-12-6-5-7-12/h1,12,17H,4-11H2,2H3,(H2,14,15,16) |
| InChIKey | YZOGANSORRYUFU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|