C17H35N5O3S — CID 111779281
1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111779281) has the molecular formula C17H35N5O3S and a molecular weight of 389.57 g/mol. Its IUPAC name is 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111779281 |
| Molecular Formula | C17H35N5O3S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NCCS(=O)(=O)NCC1CCC1 |
| InChI | InChI=1S/C17H35N5O3S/c1-2-18-17(19-7-4-9-22-10-12-25-13-11-22)20-8-14-26(23,24)21-15-16-5-3-6-16/h16,21H,2-15H2,1H3,(H2,18,19,20) |
| InChIKey | YJFIUULHVSWGFN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|