C13H28N4O3S — CID 111188233
1-ethyl-3-(2-ethylsulfonylethyl)-2-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111188233) has the molecular formula C13H28N4O3S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-ethyl-3-(2-ethylsulfonylethyl)-2-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111188233 |
| Molecular Formula | C13H28N4O3S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCN1CCOCC1)NCCS(=O)(=O)CC |
| InChI | InChI=1S/C13H28N4O3S/c1-3-14-13(16-6-12-21(18,19)4-2)15-5-7-17-8-10-20-11-9-17/h3-12H2,1-2H3,(H2,14,15,16) |
| InChIKey | LPUMYFNHCWFWMF-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|