C12H26N4O2S — CID 111111986
2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1,3-diethylguanidine (PubChem CID 111111986) has the molecular formula C12H26N4O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1,3-diethylguanidine.
| Compound Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 111111986 |
| Molecular Formula | C12H26N4O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCCS(=O)(=O)NCC1CCC1)NCC |
| InChI | InChI=1S/C12H26N4O2S/c1-3-13-12(14-4-2)15-8-9-19(17,18)16-10-11-6-5-7-11/h11,16H,3-10H2,1-2H3,(H2,13,14,15) |
| InChIKey | SLGMORJIMMRZJQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|