C16H33IN4O2S2 — CID 109486973
N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486973) has the molecular formula C16H33IN4O2S2 and a molecular weight of 504.50 g/mol. Its IUPAC name is N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486973 |
| Molecular Formula | C16H33IN4O2S2 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCC1CCC1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C16H32N4O2S2.HI/c1-3-15-13-20(9-10-23-15)16(17-4-2)18-8-11-24(21,22)19-12-14-6-5-7-14;/h14-15,19H,3-13H2,1-2H3,(H,17,18);1H |
| InChIKey | OJZFXYZRXZGEGQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|