C15H31N3OS — CID 109485608
N'-(2-butoxyethyl)-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109485608) has the molecular formula C15H31N3OS and a molecular weight of 301.50 g/mol. Its IUPAC name is N'-(2-butoxyethyl)-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-(2-butoxyethyl)-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485608 |
| Molecular Formula | C15H31N3OS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N'-(2-butoxyethyl)-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCCCOCC/N=C(\NCC)N1CCSC(CC)C1 |
| InChI | InChI=1S/C15H31N3OS/c1-4-7-10-19-11-8-17-15(16-6-3)18-9-12-20-14(5-2)13-18/h14H,4-13H2,1-3H3,(H,16,17) |
| InChIKey | ASFYBHYMEQQREF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|