C14H27F3N4S — CID 109485712
N,2-diethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]thiomorpholine-4-carboximidamide (PubChem CID 109485712) has the molecular formula C14H27F3N4S and a molecular weight of 340.46 g/mol. Its IUPAC name is N,2-diethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485712 |
| Molecular Formula | C14H27F3N4S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N,2-diethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCN(C)CC(F)(F)F)N1CCSC(CC)C1 |
| InChI | InChI=1S/C14H27F3N4S/c1-4-12-10-21(8-9-22-12)13(18-5-2)19-6-7-20(3)11-14(15,16)17/h12H,4-11H2,1-3H3,(H,18,19) |
| InChIKey | KEJVYWBQHHAURX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|