C17H33N5OS — CID 109486786
N'-[2-(4-acetylpiperazin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109486786) has the molecular formula C17H33N5OS and a molecular weight of 355.55 g/mol. Its IUPAC name is N'-[2-(4-acetylpiperazin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(4-acetylpiperazin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486786 |
| Molecular Formula | C17H33N5OS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | N'-[2-(4-acetylpiperazin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCN1CCN(C(C)=O)CC1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C17H33N5OS/c1-4-16-14-22(12-13-24-16)17(18-5-2)19-6-7-20-8-10-21(11-9-20)15(3)23/h16H,4-14H2,1-3H3,(H,18,19) |
| InChIKey | IWXHHCFCVIGMJU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|