C16H28N4O2S — CID 109485266
N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109485266) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485266 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCN1C(=O)CCCC1=O)N1CCSC(CC)C1 |
| InChI | InChI=1S/C16H28N4O2S/c1-3-13-12-19(10-11-23-13)16(17-4-2)18-8-9-20-14(21)6-5-7-15(20)22/h13H,3-12H2,1-2H3,(H,17,18) |
| InChIKey | BKEFMTQNYYYJCB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|