C19H32N4OS — CID 109487166
N,2-diethyl-N'-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]thiomorpholine-4-carboximidamide (PubChem CID 109487166) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is N,2-diethyl-N'-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109487166 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N,2-diethyl-N'-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCCCn1c(C)cccc1=O)N1CCSC(CC)C1 |
| InChI | InChI=1S/C19H32N4OS/c1-4-17-15-22(13-14-25-17)19(20-5-2)21-11-6-7-12-23-16(3)9-8-10-18(23)24/h8-10,17H,4-7,11-15H2,1-3H3,(H,20,21) |
| InChIKey | DCZIGGIYBMTQCV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|