C16H25N3S — CID 109486214
N'-benzyl-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109486214) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is N'-benzyl-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-benzyl-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486214 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N'-benzyl-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C16H25N3S/c1-3-15-13-19(10-11-20-15)16(17-4-2)18-12-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,17,18) |
| InChIKey | NJZKIPQEBRGVLA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|