C20H32N4OS — CID 109484666
N,2-diethyl-N'-[(4-morpholin-4-ylphenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 109484666) has the molecular formula C20H32N4OS and a molecular weight of 376.57 g/mol. Its IUPAC name is N,2-diethyl-N'-[(4-morpholin-4-ylphenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[(4-morpholin-4-ylphenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109484666 |
| Molecular Formula | C20H32N4OS |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N,2-diethyl-N'-[(4-morpholin-4-ylphenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOCC2)cc1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C20H32N4OS/c1-3-19-16-24(11-14-26-19)20(21-4-2)22-15-17-5-7-18(8-6-17)23-9-12-25-13-10-23/h5-8,19H,3-4,9-16H2,1-2H3,(H,21,22) |
| InChIKey | LBWBHWIZTRYFTF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|