C20H32IN5OS — CID 109486259
N,2-diethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486259) has the molecular formula C20H32IN5OS and a molecular weight of 517.48 g/mol. Its IUPAC name is N,2-diethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N,2-diethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486259 |
| Molecular Formula | C20H32IN5OS |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N,2-diethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C20H31N5OS.HI/c1-3-18-14-25(11-12-27-18)20(21-4-2)23-13-16-5-7-17(8-6-16)24-10-9-22-19(26)15-24;/h5-8,18H,3-4,9-15H2,1-2H3,(H,21,23)(H,22,26);1H |
| InChIKey | KWXMERISALMNBF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|