C18H29FIN3OS — CID 109486077
N,2-diethyl-N'-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486077) has the molecular formula C18H29FIN3OS and a molecular weight of 481.42 g/mol. Its IUPAC name is N,2-diethyl-N'-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N,2-diethyl-N'-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486077 |
| Molecular Formula | C18H29FIN3OS |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N,2-diethyl-N'-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(COC)c1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C18H28FN3OS.HI/c1-4-16-12-22(8-9-24-16)18(20-5-2)21-11-14-6-7-17(19)15(10-14)13-23-3;/h6-7,10,16H,4-5,8-9,11-13H2,1-3H3,(H,20,21);1H |
| InChIKey | DXKDFLXMANMMQA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|