C20H30N4S — CID 109486056
N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109486056) has the molecular formula C20H30N4S and a molecular weight of 358.56 g/mol. Its IUPAC name is N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486056 |
| Molecular Formula | C20H30N4S |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CC=CC2)cc1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C20H30N4S/c1-3-19-16-24(13-14-25-19)20(21-4-2)22-15-17-7-9-18(10-8-17)23-11-5-6-12-23/h5-10,19H,3-4,11-16H2,1-2H3,(H,21,22) |
| InChIKey | XGYJELIJRUWYCB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|